C15H21N — CID 143828495
(4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-4-ethylidene-1,3-dimethyl-5-propylidenepyrrole (PubChem CID 143828495) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-4-ethylidene-1,3-dimethyl-5-propylidenepyrrole.
| Compound Name | (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-4-ethylidene-1,3-dimethyl-5-propylidenepyrrole |
|---|---|
| PubChem CID | 143828495 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-4-ethylidene-1,3-dimethyl-5-propylidenepyrrole |
| SMILES | C=C/C=C\c1c(C)c(=C/C)/c(=C\CC)n1C |
| InChI | InChI=1S/C15H21N/c1-6-9-11-14-12(4)13(8-3)15(10-7-2)16(14)5/h6,8-11H,1,7H2,2-5H3/b11-9-,13-8-,15-10+ |
| InChIKey | BEOQZGBVCIPVNS-UWNIGNCTSA-N |
| XLogP | 2.52 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|