C15H26N4O — CID 143293690
ethane;4-(ethenyliminomethyl)-5-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one (PubChem CID 143293690) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is ethane;4-(ethenyliminomethyl)-5-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one.
| Compound Name | ethane;4-(ethenyliminomethyl)-5-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 143293690 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | ethane;4-(ethenyliminomethyl)-5-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one |
| SMILES | C=C/N=C/c1c(C)[nH]c(=O)n1C1CCN(C)CC1.CC |
| InChI | InChI=1S/C13H20N4O.C2H6/c1-4-14-9-12-10(2)15-13(18)17(12)11-5-7-16(3)8-6-11;1-2/h4,9,11H,1,5-8H2,2-3H3,(H,15,18);1-2H3/b14-9+; |
| InChIKey | HXOUBSJOOFNMOV-KYIGKLDSSA-N |
| XLogP | 2.34 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|