C14H23N5O2 — CID 143218100
4-[4-ethenyl-5-[(Z)-ethylideneamino]-2-oxo-1H-imidazol-3-yl]piperidine-1-carbaldehyde;methanamine (PubChem CID 143218100) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[4-ethenyl-5-[(Z)-ethylideneamino]-2-oxo-1H-imidazol-3-yl]piperidine-1-carbaldehyde;methanamine.
| Compound Name | 4-[4-ethenyl-5-[(Z)-ethylideneamino]-2-oxo-1H-imidazol-3-yl]piperidine-1-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 143218100 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-[4-ethenyl-5-[(Z)-ethylideneamino]-2-oxo-1H-imidazol-3-yl]piperidine-1-carbaldehyde;methanamine |
| SMILES | C=Cc1c(/N=C\C)[nH]c(=O)n1C1CCN(C=O)CC1.CN |
| InChI | InChI=1S/C13H18N4O2.CH5N/c1-3-11-12(14-4-2)15-13(19)17(11)10-5-7-16(9-18)8-6-10;1-2/h3-4,9-10H,1,5-8H2,2H3,(H,15,19);2H2,1H3/b14-4-; |
| InChIKey | XZSSINWBTZKKON-CYBPKNTASA-N |
| XLogP | 0.91 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|