C14H20N4O2 — CID 142441053
ethane;4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidine-1-carbaldehyde (PubChem CID 142441053) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethane;4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidine-1-carbaldehyde.
| Compound Name | ethane;4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 142441053 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethane;4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidine-1-carbaldehyde |
| SMILES | CC.O=CN1CCC(n2c(=O)[nH]c3ncccc32)CC1 |
| InChI | InChI=1S/C12H14N4O2.C2H6/c17-8-15-6-3-9(4-7-15)16-10-2-1-5-13-11(10)14-12(16)18;1-2/h1-2,5,8-9H,3-4,6-7H2,(H,13,14,18);1-2H3 |
| InChIKey | ILVRPPVNEIOVEX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|