C14H22N4O — CID 143218186
ethane;1-(1-methylpiperidin-4-yl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 143218186) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is ethane;1-(1-methylpiperidin-4-yl)-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | ethane;1-(1-methylpiperidin-4-yl)-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 143218186 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | ethane;1-(1-methylpiperidin-4-yl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CC.CN1CCC(n2c(=O)[nH]c3ncccc32)CC1 |
| InChI | InChI=1S/C12H16N4O.C2H6/c1-15-7-4-9(5-8-15)16-10-3-2-6-13-11(10)14-12(16)17;1-2/h2-3,6,9H,4-5,7-8H2,1H3,(H,13,14,17);1-2H3 |
| InChIKey | YUYJDECCMBNPEA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |