C15H19N3O2 — CID 117261515
7-methyl-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione (PubChem CID 117261515) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 7-methyl-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-methyl-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261515 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 7-methyl-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione |
| SMILES | Cc1ccc2c(=O)n(C3CCN(C)CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-3-4-12-13(9-10)16-15(20)18(14(12)19)11-5-7-17(2)8-6-11/h3-4,9,11H,5-8H2,1-2H3,(H,16,20) |
| InChIKey | UACVDAGKPZNXLE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |