C16H21N3O3 — CID 117261540
3-(1-ethylpiperidin-4-yl)-7-methoxy-1H-quinazoline-2,4-dione (PubChem CID 117261540) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)-7-methoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-(1-ethylpiperidin-4-yl)-7-methoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261540 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)-7-methoxy-1H-quinazoline-2,4-dione |
| SMILES | CCN1CCC(n2c(=O)[nH]c3cc(OC)ccc3c2=O)CC1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-18-8-6-11(7-9-18)19-15(20)13-5-4-12(22-2)10-14(13)17-16(19)21/h4-5,10-11H,3,6-9H2,1-2H3,(H,17,21) |
| InChIKey | ZBVSXGBLOQAXFU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |