C14H16ClN3O2 — CID 117261256
6-chloro-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione (PubChem CID 117261256) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 6-chloro-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione.
| Compound Name | 6-chloro-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261256 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 6-chloro-3-(1-methylpiperidin-4-yl)-1H-quinazoline-2,4-dione |
| SMILES | CN1CCC(n2c(=O)[nH]c3ccc(Cl)cc3c2=O)CC1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-17-6-4-10(5-7-17)18-13(19)11-8-9(15)2-3-12(11)16-14(18)20/h2-3,8,10H,4-7H2,1H3,(H,16,20) |
| InChIKey | RDMGMBQHXZGATF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |