C34H46N6O4 — CID 158247867
6-amino-3-(4-propan-2-ylcyclohexyl)-1H-quinazoline-2,4-dione (PubChem CID 158247867) has the molecular formula C34H46N6O4 and a molecular weight of 602.78 g/mol. Its IUPAC name is 6-amino-3-(4-propan-2-ylcyclohexyl)-1H-quinazoline-2,4-dione.
| Compound Name | 6-amino-3-(4-propan-2-ylcyclohexyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 158247867 |
| Molecular Formula | C34H46N6O4 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 6-amino-3-(4-propan-2-ylcyclohexyl)-1H-quinazoline-2,4-dione |
| SMILES | CC(C)C1CCC(n2c(=O)[nH]c3ccc(N)cc3c2=O)CC1.CC(C)C1CCC(n2c(=O)[nH]c3ccc(N)cc3c2=O)CC1 |
| InChI | InChI=1S/2C17H23N3O2/c2*1-10(2)11-3-6-13(7-4-11)20-16(21)14-9-12(18)5-8-15(14)19-17(20)22/h2*5,8-11,13H,3-4,6-7,18H2,1-2H3,(H,19,22) |
| InChIKey | GGIRMKMOLXPHKD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|