About 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol
6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol (PubChem CID 143228246) has the molecular formula C17H31NOS
and a molecular weight of 297.51 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol.
Molecular Properties
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol |
| PubChem CID | 143228246 |
| Molecular Formula | C17H31NOS |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol |
| SMILES | C=C/C=C\C1=C(C=C)CCC(=O)N1C.CC.CC.CS |
| InChI | InChI=1S/C12H15NO.2C2H6.CH4S/c1-4-6-7-11-10(5-2)8-9-12(14)13(11)3;3*1-2/h4-7H,1-2,8-9H2,3H3;2*1-2H3;2H,1H3/b7-6-;;; |
| InChIKey | UFHVRRDRVCGDKX-YYFHNNNUSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol?
The IUPAC name of 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol (CID 143228246) is 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol.
What is the SMILES notation for 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol?
The canonical SMILES for 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol is C=C/C=C\C1=C(C=C)CCC(=O)N1C.CC.CC.CS.
What is the InChIKey of 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol?
The InChIKey is UFHVRRDRVCGDKX-YYFHNNNUSA-N. The full InChI is InChI=1S/C12H15NO.2C2H6.CH4S/c1-4-6-7-11-10(5-2)8-9-12(14)13(11)3;3*1-2/h4-7H,1-2,8-9H2,3H3;2*1-2H3;2H,1H3/b7-6-;;;.
What are the key properties of 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol?
6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol has a molecular weight of 297.51 g/mol, XLogP of 5.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-methyl-3,4-dihydropyridin-2-one;ethane;methanethiol is sourced from PubChem (CID 143228246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).