C19H31N — CID 155709835
3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-8-ethyl-8-azaspiro[4.5]dec-2-ene;ethane (PubChem CID 155709835) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-8-ethyl-8-azaspiro[4.5]dec-2-ene;ethane.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-8-ethyl-8-azaspiro[4.5]dec-2-ene;ethane |
|---|---|
| PubChem CID | 155709835 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-8-ethyl-8-azaspiro[4.5]dec-2-ene;ethane |
| SMILES | C=C/C=C\C1=C(C=C)CC2(CCN(CC)CC2)C1.CC |
| InChI | InChI=1S/C17H25N.C2H6/c1-4-7-8-16-14-17(13-15(16)5-2)9-11-18(6-3)12-10-17;1-2/h4-5,7-8H,1-2,6,9-14H2,3H3;1-2H3/b8-7-; |
| InChIKey | XOLKKGCAYKDMQU-CFYXSCKTSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|