C10H13IN2 — CID 147054119
6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-4-iodo-2,3-dihydro-1H-pyrazine (PubChem CID 147054119) has the molecular formula C10H13IN2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-4-iodo-2,3-dihydro-1H-pyrazine.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-4-iodo-2,3-dihydro-1H-pyrazine |
|---|---|
| PubChem CID | 147054119 |
| Molecular Formula | C10H13IN2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-5-ethenyl-4-iodo-2,3-dihydro-1H-pyrazine |
| SMILES | C=C/C=C\C1=C(C=C)N(I)CCN1 |
| InChI | InChI=1S/C10H13IN2/c1-3-5-6-9-10(4-2)13(11)8-7-12-9/h3-6,12H,1-2,7-8H2/b6-5- |
| InChIKey | BBWXLDBQQFPDGT-WAYWQWQTSA-N |
| XLogP | 2.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|