C14H26N2 — CID 143195742
1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5,6-dihydro-4H-pyrimidine;ethane (PubChem CID 143195742) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5,6-dihydro-4H-pyrimidine;ethane.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5,6-dihydro-4H-pyrimidine;ethane |
|---|---|
| PubChem CID | 143195742 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5,6-dihydro-4H-pyrimidine;ethane |
| SMILES | C=C/C=C\N1CCCN=C1C=C.CC.CC |
| InChI | InChI=1S/C10H14N2.2C2H6/c1-3-5-8-12-9-6-7-11-10(12)4-2;2*1-2/h3-5,8H,1-2,6-7,9H2;2*1-2H3/b8-5-;; |
| InChIKey | ITZVIRCHLACFMP-XTKZWJJBSA-N |
| XLogP | 4.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|