C5H11N3 — CID 142204479
2-methyl-5,6-dihydro-4H-pyrimidin-1-amine (PubChem CID 142204479) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-methyl-5,6-dihydro-4H-pyrimidin-1-amine.
| Compound Name | 2-methyl-5,6-dihydro-4H-pyrimidin-1-amine |
|---|---|
| PubChem CID | 142204479 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2-methyl-5,6-dihydro-4H-pyrimidin-1-amine |
| SMILES | CC1=NCCCN1N |
| InChI | InChI=1S/C5H11N3/c1-5-7-3-2-4-8(5)6/h2-4,6H2,1H3 |
| InChIKey | OIXLOQGCUYZNTC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|