C11H21N3 — CID 150582155
N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine (PubChem CID 150582155) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine.
| Compound Name | N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
|---|---|
| PubChem CID | 150582155 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
| SMILES | CN(C)C1CCCCC2=NCCCN21 |
| InChI | InChI=1S/C11H21N3/c1-13(2)11-7-4-3-6-10-12-8-5-9-14(10)11/h11H,3-9H2,1-2H3 |
| InChIKey | IOBHGPPXCSGVCU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |