C10H18N2 — CID 13775860
6-Methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 13775860) has the molecular formula C10H18N2 and a molecular weight of 166.26 g/mol. Its IUPAC name is 6-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | 6-Methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 13775860 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 6-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | CC1CCCCC2=NCCCN12 |
| InChI | InChI=1S/C10H18N2/c1-9-5-2-3-6-10-11-7-4-8-12(9)10/h9H,2-8H2,1H3 |
| InChIKey | CGJKLVHKQLKPPU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 186 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |