C9H15ClN2 — CID 139950765
6-chloro-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 139950765) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 6-chloro-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | 6-chloro-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 139950765 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-chloro-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | ClC1CCCCC2=NCCCN21 |
| InChI | InChI=1S/C9H15ClN2/c10-8-4-1-2-5-9-11-6-3-7-12(8)9/h8H,1-7H2 |
| InChIKey | DPFYWCZVVAFEGM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|