C15H31N3 — CID 67662818
N,N-diethylethanamine;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 67662818) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N,N-diethylethanamine;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | N,N-diethylethanamine;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 67662818 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N,N-diethylethanamine;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | C1CCC2=NCCCN2CC1.CCN(CC)CC |
| InChI | InChI=1S/C9H16N2.C6H15N/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-4-7(5-2)6-3/h1-8H2;4-6H2,1-3H3 |
| InChIKey | TWOWCWHMYCUKRN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |