C12H19NS — CID 142198473
4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-methylidene-3H-1,4-thiazine;ethane (PubChem CID 142198473) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-methylidene-3H-1,4-thiazine;ethane.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-methylidene-3H-1,4-thiazine;ethane |
|---|---|
| PubChem CID | 142198473 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-methylidene-3H-1,4-thiazine;ethane |
| SMILES | C=C/C=C\N1CC(=C)SC=C1C.CC |
| InChI | InChI=1S/C10H13NS.C2H6/c1-4-5-6-11-7-10(3)12-8-9(11)2;1-2/h4-6,8H,1,3,7H2,2H3;1-2H3/b6-5-; |
| InChIKey | WIXRYAJLGAGFCI-YSMBQZINSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|