C13H16S — CID 144960182
(2E,6Z,8Z)-3-[(1Z)-buta-1,3-dienyl]-2-methyl-4,5-dihydrothionine (PubChem CID 144960182) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is (2E,6Z,8Z)-3-[(1Z)-buta-1,3-dienyl]-2-methyl-4,5-dihydrothionine.
| Compound Name | (2E,6Z,8Z)-3-[(1Z)-buta-1,3-dienyl]-2-methyl-4,5-dihydrothionine |
|---|---|
| PubChem CID | 144960182 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2E,6Z,8Z)-3-[(1Z)-buta-1,3-dienyl]-2-methyl-4,5-dihydrothionine |
| SMILES | C=C/C=C\C1=C(/C)S/C=C\C=C/CC1 |
| InChI | InChI=1S/C13H16S/c1-3-4-9-13-10-7-5-6-8-11-14-12(13)2/h3-6,8-9,11H,1,7,10H2,2H3/b6-5-,9-4-,11-8-,13-12- |
| InChIKey | ZOYSGYPKZBFBRO-SGLOJJBSSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|