C17H20 — CID 142155353
7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-8,9-dihydro-5H-benzo[7]annulene (PubChem CID 142155353) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-8,9-dihydro-5H-benzo[7]annulene.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-8,9-dihydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 142155353 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-8,9-dihydro-5H-benzo[7]annulene |
| SMILES | C=C/C=C\C1=C(C)Cc2ccc(C)cc2CC1 |
| InChI | InChI=1S/C17H20/c1-4-5-6-15-9-10-16-11-13(2)7-8-17(16)12-14(15)3/h4-8,11H,1,9-10,12H2,2-3H3/b6-5- |
| InChIKey | HWTUHXLZTCELQK-WAYWQWQTSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|