C18H22 — CID 142100998
(15Z)-6-methyltricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,15-pentaene (PubChem CID 142100998) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is (15Z)-6-methyltricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,15-pentaene.
| Compound Name | (15Z)-6-methyltricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,15-pentaene |
|---|---|
| PubChem CID | 142100998 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (15Z)-6-methyltricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,15-pentaene |
| SMILES | Cc1ccc2c(c1)CCC1=C(C/C=C\CCC1)C2 |
| InChI | InChI=1S/C18H22/c1-14-8-9-18-13-16-7-5-3-2-4-6-15(16)10-11-17(18)12-14/h3,5,8-9,12H,2,4,6-7,10-11,13H2,1H3/b5-3- |
| InChIKey | QGZZGYNGTDSRHN-HYXAFXHYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|