C16H19N — CID 142002529
6,13-dimethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),6,12,14-pentaene (PubChem CID 142002529) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 6,13-dimethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),6,12,14-pentaene.
| Compound Name | 6,13-dimethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),6,12,14-pentaene |
|---|---|
| PubChem CID | 142002529 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6,13-dimethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),6,12,14-pentaene |
| SMILES | CC1=CC2=C(Cc3ccc(C)cc3CC2)NC1 |
| InChI | InChI=1S/C16H19N/c1-11-3-4-14-9-16-15(6-5-13(14)7-11)8-12(2)10-17-16/h3-4,7-8,17H,5-6,9-10H2,1-2H3 |
| InChIKey | KOYCRZACVCVKND-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |