About 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]
6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] (PubChem CID 115012486) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane].
Analyze 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The IUPAC name of 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] (CID 115012486) is 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane].
What is the SMILES notation for 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The canonical SMILES for 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] is Cc1ccc2c(c1)CNC21CC1.
What is the InChIKey of 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The InChIKey is IUXJRJFNFORTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-2-3-10-9(6-8)7-12-11(10)4-5-11/h2-3,6,12H,4-5,7H2,1H3.
What are the key properties of 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] has a molecular weight of 159.23 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] is sourced from PubChem (CID 115012486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).