C13H14 — CID 167646875
6-methyl-2-methylidenespiro[1H-indene-3,1'-cyclopropane] (PubChem CID 167646875) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 6-methyl-2-methylidenespiro[1H-indene-3,1'-cyclopropane].
| Compound Name | 6-methyl-2-methylidenespiro[1H-indene-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 167646875 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 6-methyl-2-methylidenespiro[1H-indene-3,1'-cyclopropane] |
| SMILES | C=C1Cc2cc(C)ccc2C12CC2 |
| InChI | InChI=1S/C13H14/c1-9-3-4-12-11(7-9)8-10(2)13(12)5-6-13/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | RRUKOMDGCQWQIT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|