C24H28O2 — CID 102275839
(1S,2E)-1-ethyl-2-[(3S)-3-ethyl-3-hydroxy-6-methyl-1H-inden-2-ylidene]-6-methyl-3H-inden-1-ol (PubChem CID 102275839) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1S,2E)-1-ethyl-2-[(3S)-3-ethyl-3-hydroxy-6-methyl-1H-inden-2-ylidene]-6-methyl-3H-inden-1-ol.
| Compound Name | (1S,2E)-1-ethyl-2-[(3S)-3-ethyl-3-hydroxy-6-methyl-1H-inden-2-ylidene]-6-methyl-3H-inden-1-ol |
|---|---|
| PubChem CID | 102275839 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (1S,2E)-1-ethyl-2-[(3S)-3-ethyl-3-hydroxy-6-methyl-1H-inden-2-ylidene]-6-methyl-3H-inden-1-ol |
| SMILES | CC[C@]1(O)/C(=C2\Cc3ccc(C)cc3[C@]2(O)CC)Cc2cc(C)ccc21 |
| InChI | InChI=1S/C24H28O2/c1-5-23(25)19-10-8-15(3)11-18(19)14-22(23)21-13-17-9-7-16(4)12-20(17)24(21,26)6-2/h7-12,25-26H,5-6,13-14H2,1-4H3/b22-21+/t23-,24-/m1/s1 |
| InChIKey | WVAJTJVLBPFKMG-UEQYXDAXSA-N |
| XLogP | 4.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|