C17H26 — CID 154146659
3-ethyl-1,1,2,2,3,5-hexamethylindene (PubChem CID 154146659) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3-ethyl-1,1,2,2,3,5-hexamethylindene.
| Compound Name | 3-ethyl-1,1,2,2,3,5-hexamethylindene |
|---|---|
| PubChem CID | 154146659 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-ethyl-1,1,2,2,3,5-hexamethylindene |
| SMILES | CCC1(C)c2cc(C)ccc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H26/c1-8-17(7)14-11-12(2)9-10-13(14)15(3,4)16(17,5)6/h9-11H,8H2,1-7H3 |
| InChIKey | ZKVMXKSVQHUYHU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |