C20H25N — CID 71605999
2-benzyl-1,1,3,3,5-pentamethylisoindole (PubChem CID 71605999) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-benzyl-1,1,3,3,5-pentamethylisoindole.
| Compound Name | 2-benzyl-1,1,3,3,5-pentamethylisoindole |
|---|---|
| PubChem CID | 71605999 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-benzyl-1,1,3,3,5-pentamethylisoindole |
| SMILES | Cc1ccc2c(c1)C(C)(C)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C20H25N/c1-15-11-12-17-18(13-15)20(4,5)21(19(17,2)3)14-16-9-7-6-8-10-16/h6-13H,14H2,1-5H3 |
| InChIKey | NGIDXHVJHHGHGB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |