C13H18N2 — CID 84721497
6-methylspiro[1,2-dihydroisoindole-3,4'-piperidine] (PubChem CID 84721497) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-methylspiro[1,2-dihydroisoindole-3,4'-piperidine].
| Compound Name | 6-methylspiro[1,2-dihydroisoindole-3,4'-piperidine] |
|---|---|
| PubChem CID | 84721497 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 6-methylspiro[1,2-dihydroisoindole-3,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)CNC21CCNCC1 |
| InChI | InChI=1S/C13H18N2/c1-10-2-3-12-11(8-10)9-15-13(12)4-6-14-7-5-13/h2-3,8,14-15H,4-7,9H2,1H3 |
| InChIKey | JEMKDVBSMKFZDD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |