C14H19NO — CID 104696992
7-methylspiro[2,3-dihydro-1H-isoquinoline-4,4'-oxane] (PubChem CID 104696992) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 7-methylspiro[2,3-dihydro-1H-isoquinoline-4,4'-oxane].
| Compound Name | 7-methylspiro[2,3-dihydro-1H-isoquinoline-4,4'-oxane] |
|---|---|
| PubChem CID | 104696992 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 7-methylspiro[2,3-dihydro-1H-isoquinoline-4,4'-oxane] |
| SMILES | Cc1ccc2c(c1)CNCC21CCOCC1 |
| InChI | InChI=1S/C14H19NO/c1-11-2-3-13-12(8-11)9-15-10-14(13)4-6-16-7-5-14/h2-3,8,15H,4-7,9-10H2,1H3 |
| InChIKey | SQARKOOQDKTXDH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |