C17H27N — CID 123656510
propane;spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] (PubChem CID 123656510) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is propane;spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane].
| Compound Name | propane;spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 123656510 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | propane;spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] |
| SMILES | CCC.c1ccc2c(c1)CNCC21CCCCC1 |
| InChI | InChI=1S/C14H19N.C3H8/c1-4-8-14(9-5-1)11-15-10-12-6-2-3-7-13(12)14;1-3-2/h2-3,6-7,15H,1,4-5,8-11H2;3H2,1-2H3 |
| InChIKey | ZAVSHDSZZDOEMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |