About ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane]
ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 123637985) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane].
Molecular Properties
| Compound Name | ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] |
| PubChem CID | 123637985 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CC.c1ccc2c(c1)NCC21CCCCC1 |
| InChI | InChI=1S/C13H17N.C2H6/c1-4-8-13(9-5-1)10-14-12-7-3-2-6-11(12)13;1-2/h2-3,6-7,14H,1,4-5,8-10H2;1-2H3 |
| InChIKey | OOLIOADTVBPIJJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane]?
The IUPAC name of ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] (CID 123637985) is ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane].
What is the SMILES notation for ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane]?
The canonical SMILES for ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] is CC.c1ccc2c(c1)NCC21CCCCC1.
What is the InChIKey of ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane]?
The InChIKey is OOLIOADTVBPIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.C2H6/c1-4-8-13(9-5-1)10-14-12-7-3-2-6-11(12)13;1-2/h2-3,6-7,14H,1,4-5,8-10H2;1-2H3.
What are the key properties of ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane]?
ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] has a molecular weight of 217.36 g/mol, XLogP of 4.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] is sourced from PubChem (CID 123637985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).