C15H23N — CID 123637985
ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 123637985) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 123637985 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | ethane;spiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CC.c1ccc2c(c1)NCC21CCCCC1 |
| InChI | InChI=1S/C13H17N.C2H6/c1-4-8-13(9-5-1)10-14-12-7-3-2-6-11(12)13;1-2/h2-3,6-7,14H,1,4-5,8-10H2;1-2H3 |
| InChIKey | OOLIOADTVBPIJJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |