C11H16N2 — CID 174390026
N,N,3-trimethyl-1,2-dihydroindol-3-amine (PubChem CID 174390026) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N,N,3-trimethyl-1,2-dihydroindol-3-amine.
| Compound Name | N,N,3-trimethyl-1,2-dihydroindol-3-amine |
|---|---|
| PubChem CID | 174390026 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N,N,3-trimethyl-1,2-dihydroindol-3-amine |
| SMILES | CN(C)C1(C)CNc2ccccc21 |
| InChI | InChI=1S/C11H16N2/c1-11(13(2)3)8-12-10-7-5-4-6-9(10)11/h4-7,12H,8H2,1-3H3 |
| InChIKey | WVGGMUDCCFQPPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |