About 3-iodo-3-methyl-1,2-dihydroindole
3-iodo-3-methyl-1,2-dihydroindole (PubChem CID 166899388) has the molecular formula C9H10IN
and a molecular weight of 259.09 g/mol. Its IUPAC name is 3-iodo-3-methyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3-iodo-3-methyl-1,2-dihydroindole |
| PubChem CID | 166899388 |
| Molecular Formula | C9H10IN |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-iodo-3-methyl-1,2-dihydroindole |
| SMILES | CC1(I)CNc2ccccc21 |
| InChI | InChI=1S/C9H10IN/c1-9(10)6-11-8-5-3-2-4-7(8)9/h2-5,11H,6H2,1H3 |
| InChIKey | IGYPFZQYRVNSFK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-3-methyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-3-methyl-1,2-dihydroindole?
The IUPAC name of 3-iodo-3-methyl-1,2-dihydroindole (CID 166899388) is 3-iodo-3-methyl-1,2-dihydroindole.
What is the SMILES notation for 3-iodo-3-methyl-1,2-dihydroindole?
The canonical SMILES for 3-iodo-3-methyl-1,2-dihydroindole is CC1(I)CNc2ccccc21.
What is the InChIKey of 3-iodo-3-methyl-1,2-dihydroindole?
The InChIKey is IGYPFZQYRVNSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10IN/c1-9(10)6-11-8-5-3-2-4-7(8)9/h2-5,11H,6H2,1H3.
What are the key properties of 3-iodo-3-methyl-1,2-dihydroindole?
3-iodo-3-methyl-1,2-dihydroindole has a molecular weight of 259.09 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-3-methyl-1,2-dihydroindole is sourced from PubChem (CID 166899388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).