C15H23N2OP — CID 143386492
ethane;phosphanyl(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)methanone (PubChem CID 143386492) has the molecular formula C15H23N2OP and a molecular weight of 278.34 g/mol. Its IUPAC name is ethane;phosphanyl(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)methanone.
| Compound Name | ethane;phosphanyl(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 143386492 |
| Molecular Formula | C15H23N2OP |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethane;phosphanyl(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)methanone |
| SMILES | CC.O=C(P)N1CCC2(CC1)CNc1ccccc12 |
| InChI | InChI=1S/C13H17N2OP.C2H6/c16-12(17)15-7-5-13(6-8-15)9-14-11-4-2-1-3-10(11)13;1-2/h1-4,14H,5-9,17H2;1-2H3 |
| InChIKey | CKOYKEHLQFUJLP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|