C19H21N3O2 — CID 77096966
1-(1-methylpyrrol-2-yl)-2-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylethane-1,2-dione (PubChem CID 77096966) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(1-methylpyrrol-2-yl)-2-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylethane-1,2-dione.
| Compound Name | 1-(1-methylpyrrol-2-yl)-2-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylethane-1,2-dione |
|---|---|
| PubChem CID | 77096966 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(1-methylpyrrol-2-yl)-2-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylethane-1,2-dione |
| SMILES | Cn1cccc1C(=O)C(=O)N1CCC2(CC1)CNc1ccccc12 |
| InChI | InChI=1S/C19H21N3O2/c1-21-10-4-7-16(21)17(23)18(24)22-11-8-19(9-12-22)13-20-15-6-3-2-5-14(15)19/h2-7,10,20H,8-9,11-13H2,1H3 |
| InChIKey | HGVBNVGSNUMEFV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|