About 3-methyl-3-piperidin-4-yl-1,2-dihydroindole
3-methyl-3-piperidin-4-yl-1,2-dihydroindole (PubChem CID 142892707) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-methyl-3-piperidin-4-yl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3-methyl-3-piperidin-4-yl-1,2-dihydroindole |
| PubChem CID | 142892707 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-methyl-3-piperidin-4-yl-1,2-dihydroindole |
| SMILES | CC1(C2CCNCC2)CNc2ccccc21 |
| InChI | InChI=1S/C14H20N2/c1-14(11-6-8-15-9-7-11)10-16-13-5-3-2-4-12(13)14/h2-5,11,15-16H,6-10H2,1H3 |
| InChIKey | AOCMXWBPAOWCCO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3-piperidin-4-yl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-piperidin-4-yl-1,2-dihydroindole?
The IUPAC name of 3-methyl-3-piperidin-4-yl-1,2-dihydroindole (CID 142892707) is 3-methyl-3-piperidin-4-yl-1,2-dihydroindole.
What is the SMILES notation for 3-methyl-3-piperidin-4-yl-1,2-dihydroindole?
The canonical SMILES for 3-methyl-3-piperidin-4-yl-1,2-dihydroindole is CC1(C2CCNCC2)CNc2ccccc21.
What is the InChIKey of 3-methyl-3-piperidin-4-yl-1,2-dihydroindole?
The InChIKey is AOCMXWBPAOWCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-14(11-6-8-15-9-7-11)10-16-13-5-3-2-4-12(13)14/h2-5,11,15-16H,6-10H2,1H3.
What are the key properties of 3-methyl-3-piperidin-4-yl-1,2-dihydroindole?
3-methyl-3-piperidin-4-yl-1,2-dihydroindole has a molecular weight of 216.33 g/mol, XLogP of 2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-piperidin-4-yl-1,2-dihydroindole is sourced from PubChem (CID 142892707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).