About CID 175964280
CID 175964280 (PubChem CID 175964280) has the molecular formula C15H20INO2
and a molecular weight of 373.23 g/mol.
Molecular Properties
| Compound Name | CID 175964280 |
| PubChem CID | 175964280 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | — |
| SMILES | I.c1ccc2c(c1)NCC21CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H19NO2.HI/c1-2-4-13-12(3-1)14(11-16-13)5-7-15(8-6-14)17-9-10-18-15;/h1-4,16H,5-11H2;1H |
| InChIKey | RTJWSSKVVGEWRU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 175964280 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175964280?
The IUPAC name of CID 175964280 (CID 175964280) is not available.
What is the SMILES notation for CID 175964280?
The canonical SMILES for CID 175964280 is I.c1ccc2c(c1)NCC21CCC2(CC1)OCCO2.
What is the InChIKey of CID 175964280?
The InChIKey is RTJWSSKVVGEWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2.HI/c1-2-4-13-12(3-1)14(11-16-13)5-7-15(8-6-14)17-9-10-18-15;/h1-4,16H,5-11H2;1H.
What are the key properties of CID 175964280?
CID 175964280 has a molecular weight of 373.23 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175964280 is sourced from PubChem (CID 175964280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).