C13H16BrN — CID 115049494
6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 115049494) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 115049494 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | Brc1ccc2c(c1)NCC21CCCCC1 |
| InChI | InChI=1S/C13H16BrN/c14-10-4-5-11-12(8-10)15-9-13(11)6-2-1-3-7-13/h4-5,8,15H,1-3,6-7,9H2 |
| InChIKey | NBHKDEYJYQTOLY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |