About 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]
6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 115049494) has the molecular formula C13H16BrN
and a molecular weight of 266.18 g/mol. Its IUPAC name is 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane].
Molecular Properties
| Compound Name | 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
| PubChem CID | 115049494 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | Brc1ccc2c(c1)NCC21CCCCC1 |
| InChI | InChI=1S/C13H16BrN/c14-10-4-5-11-12(8-10)15-9-13(11)6-2-1-3-7-13/h4-5,8,15H,1-3,6-7,9H2 |
| InChIKey | NBHKDEYJYQTOLY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]?
The IUPAC name of 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] (CID 115049494) is 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane].
What is the SMILES notation for 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]?
The canonical SMILES for 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] is Brc1ccc2c(c1)NCC21CCCCC1.
What is the InChIKey of 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]?
The InChIKey is NBHKDEYJYQTOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN/c14-10-4-5-11-12(8-10)15-9-13(11)6-2-1-3-7-13/h4-5,8,15H,1-3,6-7,9H2.
What are the key properties of 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]?
6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] has a molecular weight of 266.18 g/mol, XLogP of 4.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] is sourced from PubChem (CID 115049494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).