About (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]
(4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] (PubChem CID 129384980) has the molecular formula C13H16BrN
and a molecular weight of 266.18 g/mol. Its IUPAC name is (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine].
Molecular Properties
| Compound Name | (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] |
| PubChem CID | 129384980 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] |
| SMILES | Brc1ccc2c(c1)CCC[C@@]21CCNC1 |
| InChI | InChI=1S/C13H16BrN/c14-11-3-4-12-10(8-11)2-1-5-13(12)6-7-15-9-13/h3-4,8,15H,1-2,5-7,9H2/t13-/m0/s1 |
| InChIKey | XRCIFPDTOODVPE-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]?
The IUPAC name of (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] (CID 129384980) is (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine].
What is the SMILES notation for (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]?
The canonical SMILES for (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] is Brc1ccc2c(c1)CCC[C@@]21CCNC1.
What is the InChIKey of (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]?
The InChIKey is XRCIFPDTOODVPE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H16BrN/c14-11-3-4-12-10(8-11)2-1-5-13(12)6-7-15-9-13/h3-4,8,15H,1-2,5-7,9H2/t13-/m0/s1.
What are the key properties of (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]?
(4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] has a molecular weight of 266.18 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine] is sourced from PubChem (CID 129384980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).