C11H12BrN — CID 84629055
5-bromospiro[1,2-dihydroindene-3,3'-azetidine] (PubChem CID 84629055) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 5-bromospiro[1,2-dihydroindene-3,3'-azetidine].
| Compound Name | 5-bromospiro[1,2-dihydroindene-3,3'-azetidine] |
|---|---|
| PubChem CID | 84629055 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-bromospiro[1,2-dihydroindene-3,3'-azetidine] |
| SMILES | Brc1ccc2c(c1)C1(CC2)CNC1 |
| InChI | InChI=1S/C11H12BrN/c12-9-2-1-8-3-4-11(6-13-7-11)10(8)5-9/h1-2,5,13H,3-4,6-7H2 |
| InChIKey | MLLVSZGATDAJCQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |