C15H21Br — CID 169145643
5-bromo-3,3-di(propan-2-yl)-1,2-dihydroindene (PubChem CID 169145643) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 5-bromo-3,3-di(propan-2-yl)-1,2-dihydroindene.
| Compound Name | 5-bromo-3,3-di(propan-2-yl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 169145643 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-bromo-3,3-di(propan-2-yl)-1,2-dihydroindene |
| SMILES | CC(C)C1(C(C)C)CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H21Br/c1-10(2)15(11(3)4)8-7-12-5-6-13(16)9-14(12)15/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | BWWFDLOZTCVPNO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |