About 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane]
6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] (PubChem CID 167091801) has the molecular formula C14H17Br
and a molecular weight of 265.19 g/mol. Its IUPAC name is 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] |
| PubChem CID | 167091801 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] |
| SMILES | CC(C)C1CC12CCc1cc(Br)ccc12 |
| InChI | InChI=1S/C14H17Br/c1-9(2)13-8-14(13)6-5-10-7-11(15)3-4-12(10)14/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | ADANXBCKHQJYNV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane]?
The IUPAC name of 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] (CID 167091801) is 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane].
What is the SMILES notation for 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane]?
The canonical SMILES for 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] is CC(C)C1CC12CCc1cc(Br)ccc12.
What is the InChIKey of 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane]?
The InChIKey is ADANXBCKHQJYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Br/c1-9(2)13-8-14(13)6-5-10-7-11(15)3-4-12(10)14/h3-4,7,9,13H,5-6,8H2,1-2H3.
What are the key properties of 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane]?
6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] has a molecular weight of 265.19 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2'-propan-2-ylspiro[1,2-dihydroindene-3,1'-cyclopropane] is sourced from PubChem (CID 167091801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).