About (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine
(1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine (PubChem CID 129284661) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine.
Molecular Properties
| Compound Name | (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine |
| PubChem CID | 129284661 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine |
| SMILES | N[C@H]1CC12CCc1cc(Br)ccc12 |
| InChI | InChI=1S/C11H12BrN/c12-8-1-2-9-7(5-8)3-4-11(9)6-10(11)13/h1-2,5,10H,3-4,6,13H2/t10-,11?/m0/s1 |
| InChIKey | HPLZQVPAYLSJEZ-VUWPPUDQSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The IUPAC name of (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine (CID 129284661) is (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine.
What is the SMILES notation for (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The canonical SMILES for (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine is N[C@H]1CC12CCc1cc(Br)ccc12.
What is the InChIKey of (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The InChIKey is HPLZQVPAYLSJEZ-VUWPPUDQSA-N. The full InChI is InChI=1S/C11H12BrN/c12-8-1-2-9-7(5-8)3-4-11(9)6-10(11)13/h1-2,5,10H,3-4,6,13H2/t10-,11?/m0/s1.
What are the key properties of (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
(1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine has a molecular weight of 238.13 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1'S)-6-bromospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine is sourced from PubChem (CID 129284661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).