C14H19Br — CID 175335793
7-bromo-3,3,4,4-tetramethyl-1,2-dihydronaphthalene (PubChem CID 175335793) has the molecular formula C14H19Br and a molecular weight of 267.21 g/mol. Its IUPAC name is 7-bromo-3,3,4,4-tetramethyl-1,2-dihydronaphthalene.
| Compound Name | 7-bromo-3,3,4,4-tetramethyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 175335793 |
| Molecular Formula | C14H19Br |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 7-bromo-3,3,4,4-tetramethyl-1,2-dihydronaphthalene |
| SMILES | CC1(C)CCc2cc(Br)ccc2C1(C)C |
| InChI | InChI=1S/C14H19Br/c1-13(2)8-7-10-9-11(15)5-6-12(10)14(13,3)4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | BGVYDXDLZVHKNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |