C12H15Br — CID 144794657
6-bromo-3,3-dimethyl-2,4-dihydro-1H-naphthalene (PubChem CID 144794657) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 6-bromo-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
| Compound Name | 6-bromo-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 144794657 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-bromo-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| SMILES | CC1(C)CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C12H15Br/c1-12(2)6-5-9-3-4-11(13)7-10(9)8-12/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | FRXAEVCGAIZXCQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |