C10H11BrO — CID 122530552
5-bromo-2-methyl-1,3-dihydroinden-2-ol (PubChem CID 122530552) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is 5-bromo-2-methyl-1,3-dihydroinden-2-ol.
| Compound Name | 5-bromo-2-methyl-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 122530552 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-bromo-2-methyl-1,3-dihydroinden-2-ol |
| SMILES | CC1(O)Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H11BrO/c1-10(12)5-7-2-3-9(11)4-8(7)6-10/h2-4,12H,5-6H2,1H3 |
| InChIKey | GJPZGMIIEIWVTB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |