About 6-bromo-1,1-dimethyl-3,4-dihydroisochromene
6-bromo-1,1-dimethyl-3,4-dihydroisochromene (PubChem CID 139328426) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 6-bromo-1,1-dimethyl-3,4-dihydroisochromene.
Molecular Properties
| Compound Name | 6-bromo-1,1-dimethyl-3,4-dihydroisochromene |
| PubChem CID | 139328426 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 6-bromo-1,1-dimethyl-3,4-dihydroisochromene |
| SMILES | CC1(C)OCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H13BrO/c1-11(2)10-4-3-9(12)7-8(10)5-6-13-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | RXMAYPXTBQWALE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1,1-dimethyl-3,4-dihydroisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,1-dimethyl-3,4-dihydroisochromene?
The IUPAC name of 6-bromo-1,1-dimethyl-3,4-dihydroisochromene (CID 139328426) is 6-bromo-1,1-dimethyl-3,4-dihydroisochromene.
What is the SMILES notation for 6-bromo-1,1-dimethyl-3,4-dihydroisochromene?
The canonical SMILES for 6-bromo-1,1-dimethyl-3,4-dihydroisochromene is CC1(C)OCCc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-1,1-dimethyl-3,4-dihydroisochromene?
The InChIKey is RXMAYPXTBQWALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c1-11(2)10-4-3-9(12)7-8(10)5-6-13-11/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 6-bromo-1,1-dimethyl-3,4-dihydroisochromene?
6-bromo-1,1-dimethyl-3,4-dihydroisochromene has a molecular weight of 241.13 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,1-dimethyl-3,4-dihydroisochromene is sourced from PubChem (CID 139328426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).