C11H9BrN2O2 — CID 154872521
(3R)-5-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 154872521) has the molecular formula C11H9BrN2O2 and a molecular weight of 281.11 g/mol. Its IUPAC name is (3R)-5-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-5-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 154872521 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | (3R)-5-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)[C@]2(CCc3ccc(Br)cc32)N1 |
| InChI | InChI=1S/C11H9BrN2O2/c12-7-2-1-6-3-4-11(8(6)5-7)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16)/t11-/m1/s1 |
| InChIKey | ZHUCFBRTGREBGZ-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|