C13H10N2O2 — CID 143990894
6-ethynylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 143990894) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-ethynylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-ethynylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 143990894 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 6-ethynylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | C#Cc1ccc2c(c1)CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C13H10N2O2/c1-2-8-3-4-10-9(7-8)5-6-13(10)11(16)14-12(17)15-13/h1,3-4,7H,5-6H2,(H2,14,15,16,17) |
| InChIKey | VWLLFGZDKUYUBU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|